CAS 723278-39-5

2-[2-(tert-butoxycarbonylamino)thiazol-5-yl]acetic acid

Description:

2-[2-(tert-butoxycarbonylamino)thiazol-5-yl]acetic acid is a chemical compound characterized by its unique structural features, which include a thiazole ring and an acetic acid moiety. The presence of the tert-butoxycarbonyl (Boc) group indicates that it is likely used in peptide synthesis or as a protecting group for amines. The thiazole ring contributes to the compound's potential biological activity, as thiazoles are often found in various pharmaceuticals and bioactive molecules. This compound is typically a solid at room temperature and may exhibit solubility in polar organic solvents due to the presence of both hydrophobic and hydrophilic functional groups. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's CAS number, 723278-39-5, allows for easy identification and retrieval of information regarding its properties, safety data, and synthesis methods in chemical databases. Overall, this compound represents a versatile building block in organic synthesis and drug development.

Formula: C₁₀H₁₄N₂O₄S

InChI: InChI=1/C10H14N2O4S/c1-10(2,3)16-9(15)12-8-11-5-6(17-8)4-7(13)14/h5H,4H2,1-3H3,(H,13,14)(H,11,12,15)

SMILES: CC(C)(C)OC(=Nc1ncc(CC(=O)O)s1)O

Synonyms:

• {2-[(tert-Butoxycarbonyl)amino]-1,3-thiazol-5-yl}acetic acid

5-Thiazoleacetic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-

CAS: 723278-39-5

Formula: C₁₀H₁₄N₂O₄S

Purity: 95%

Color and Shape: Solid

Molecular weight: 258.2942

Ref: IN-DA00FH4O

2-(2-((tert-Butoxycarbonyl)amino)thiazol-5-yl)acetic acid

CAS: 723278-39-5

2-(2-((tert-Butoxycarbonyl)amino)thiazol-5-yl)acetic acid

Purity: 95%

Molecular weight: 258.29g/mol

Ref: 54-OR90642