CAS 723281-72-9

6-Bromo-4-chloro-3-nitroquinoline

Description:

6-Bromo-4-chloro-3-nitroquinoline is a heterocyclic organic compound characterized by its quinoline backbone, which consists of a fused benzene and pyridine ring. This compound features three distinct substituents: a bromine atom at the 6-position, a chlorine atom at the 4-position, and a nitro group at the 3-position. These functional groups contribute to its chemical reactivity and potential applications in various fields, including medicinal chemistry and materials science. The presence of halogens (bromine and chlorine) often enhances the compound's biological activity and lipophilicity, while the nitro group can serve as a site for further chemical modifications. The compound's molecular structure may influence its solubility, stability, and interaction with biological targets. As with many nitro-containing compounds, it may exhibit specific properties such as potential toxicity or mutagenicity, necessitating careful handling and assessment in laboratory settings. Overall, 6-Bromo-4-chloro-3-nitroquinoline represents a valuable compound for research and development in synthetic and pharmaceutical chemistry.

Formula: C₉H₄BrClN₂O₂

InChI: InChI=1S/C9H4BrClN2O2/c10-5-1-2-7-6(3-5)9(11)8(4-12-7)13(14)15/h1-4H

InChI key: InChIKey=KHKPVEMMXJCWGP-UHFFFAOYSA-N

SMILES: ClC=1C2=C(N=CC1N(=O)=O)C=CC(Br)=C2

Synonyms:

• 6-Brom-4-chlor-3-nitrochinolin
• Quinoline, 6-Bromo-4-Chloro-3-Nitro-
• 6-Bromo-4-chloro-3-nitroquinoline

6-Bromo-4-chloro-3-nitroquinoline

CAS: 723281-72-9

Formula: C₉H₄BrClN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 287.4973

Ref: IN-DA00FC0W

6-Bromo-4-chloro-3-nitroquinoline

CAS: 723281-72-9

6-Bromo-4-chloro-3-nitroquinoline

Purity: 97%

Molecular weight: 287.50g/mol

Ref: 54-OR75059

6-Bromo-4-chloro-3-nitroquinoline

CAS: 723281-72-9

Formula: C₉H₄BrClN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 287.5

Ref: 10-F050152