
CAS 723283-91-8
:Quinoline, 5-bromo-4-chloro-3-nitro-
Description:
Quinoline, 5-bromo-4-chloro-3-nitro- is a heterocyclic organic compound characterized by a quinoline backbone, which consists of a fused benzene and pyridine ring. This compound features three distinct substituents: a bromine atom at the 5-position, a chlorine atom at the 4-position, and a nitro group at the 3-position of the quinoline ring. These substituents contribute to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the nitro group typically enhances the compound's electrophilic character, making it useful in further chemical transformations. Additionally, the halogen substituents (bromine and chlorine) can influence the compound's solubility, stability, and interaction with biological systems. Quinoline derivatives are often studied for their biological activities, including antimicrobial and antimalarial properties. As with many halogenated compounds, safety and environmental considerations are important, particularly regarding their persistence and potential toxicity.
Formula:C9H4BrClN2O2
InChI:InChI=1S/C9H4BrClN2O2/c10-5-2-1-3-6-8(5)9(11)7(4-12-6)13(14)15/h1-4H
InChI key:InChIKey=BQECARAQTOQALG-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=CC1N(=O)=O)C=CC=C2Br
Synonyms:- Quinoline, 5-bromo-4-chloro-3-nitro-
- 5-Bromo-4-chloro-3-nitroquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.