
CAS 723284-34-2
:Methyl 2-hydroxy-4-methoxy-5-nitrobenzoate
Description:
Methyl 2-hydroxy-4-methoxy-5-nitrobenzoate, identified by its CAS number 723284-34-2, is an organic compound that belongs to the class of benzoates. This substance features a benzoic acid derivative structure, characterized by the presence of a methoxy group (-OCH3), a nitro group (-NO2), and a hydroxyl group (-OH) on the aromatic ring. These functional groups contribute to its chemical reactivity and potential applications. The hydroxyl group can participate in hydrogen bonding, enhancing solubility in polar solvents, while the nitro group can influence the compound's electronic properties and reactivity. Methyl 2-hydroxy-4-methoxy-5-nitrobenzoate may exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis typically involves the modification of existing benzoate derivatives through various organic reactions. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks or environmental hazards. Overall, its unique combination of functional groups makes it a valuable compound for further study in organic chemistry and medicinal applications.
Formula:C9H9NO6
InChI:InChI=1S/C9H9NO6/c1-15-8-4-7(11)5(9(12)16-2)3-6(8)10(13)14/h3-4,11H,1-2H3
InChI key:InChIKey=OZDKGSVJTFJYOC-UHFFFAOYSA-N
SMILES:O(C)C1=C(N(=O)=O)C=C(C(OC)=O)C(O)=C1
Synonyms:- Benzoic acid, 2-hydroxy-4-methoxy-5-nitro-, methyl ester
- p-Anisic acid, 2-hydroxy-5-nitro-, methyl ester
- Methyl 2-hydroxy-4-methoxy-5-nitrobenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
