CymitQuimica logo

CAS 723284-81-9

:

Benzenepropanoic acid, b-amino-3-fluoro-, (bR)-

Description:
Benzenepropanoic acid, b-amino-3-fluoro-, (bR)-, with the CAS number 723284-81-9, is a chemical compound characterized by its aromatic structure and the presence of both an amino group and a fluoro substituent on the propanoic acid backbone. This compound features a benzene ring attached to a propanoic acid moiety, which is further substituted with an amino group at the beta position relative to the carboxylic acid and a fluorine atom at the third carbon of the propanoic chain. The presence of these functional groups contributes to its potential biological activity and reactivity. As a chiral molecule, it exists in two enantiomeric forms, with the (bR)- designation indicating a specific stereochemistry. This compound may be of interest in pharmaceutical research and development due to its structural features, which could influence its interaction with biological targets. Its solubility, stability, and reactivity would depend on the specific conditions and the presence of other chemical species.
Formula:C9H10FNO2
InChI:InChI=1S/C9H10FNO2/c10-7-3-1-2-6(4-7)8(11)5-9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m1/s1
InChI key:GZNJUJNKZBHINS-MRVPVSSYSA-N
SMILES:C1=CC(=CC(=C1)F)[C@@H](CC(=O)O)N
Synonyms:
  • (R)-3-(3-Fluorophenyl)-Beta-Alanine
  • H-D-b-Phe(3-F)-OH
Found 3 products.