CymitQuimica logo

CAS 723284-85-3

:

(R)-3-Amino-3-benzo[1,3]dioxol-5-ylpropionic acid

Description:
(R)-3-Amino-3-benzo[1,3]dioxol-5-ylpropionic acid, with the CAS number 723284-85-3, is an organic compound characterized by its unique structural features, including a propionic acid backbone and a benzo[1,3]dioxole moiety. This compound exhibits chirality, with the (R) configuration indicating the specific spatial arrangement of its atoms. It is typically classified as an amino acid derivative due to the presence of an amino group (-NH2) and a carboxylic acid group (-COOH), which contribute to its potential biological activity. The benzo[1,3]dioxole structure may impart specific pharmacological properties, making it of interest in medicinal chemistry and drug development. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, its interactions with biological systems may be influenced by its stereochemistry, which can affect binding affinity to receptors or enzymes. Overall, (R)-3-Amino-3-benzo[1,3]dioxol-5-ylpropionic acid represents a compound with potential applications in pharmaceuticals and biochemistry.
Formula:C10H11NO4
InChI:InChI=1/C10H11NO4/c11-7(4-10(12)13)6-1-2-8-9(3-6)15-5-14-8/h1-3,7H,4-5,11H2,(H,12,13)/t7-/m1/s1
SMILES:c1cc2c(cc1[C@@H](CC(=O)O)N)OCO2
Synonyms:
  • (R)-3-Amino-3-(3,4-methylendioxyphenyl)propionic acid
  • (3R)-3-amino-3-(1,3-benzodioxol-5-yl)propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.