CAS 723286-82-6
:5,6,7,8-Tetrahydro-3-methoxy-1,2,4-triazolo[4,3-a]pyrazine
Description:
5,6,7,8-Tetrahydro-3-methoxy-1,2,4-triazolo[4,3-a]pyrazine is a heterocyclic compound characterized by its unique triazole and pyrazine ring structures. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, which contributes to its stability and potential biological activity. The methoxy group (-OCH3) attached to the triazole ring enhances its solubility and may influence its reactivity and interaction with biological targets. The presence of nitrogen atoms in the triazole and pyrazine rings can impart specific electronic properties, making it of interest in medicinal chemistry for potential pharmacological applications. This compound may exhibit various biological activities, including antimicrobial or anti-inflammatory properties, although specific studies would be necessary to elucidate its mechanisms of action. Its structural complexity and functional groups suggest that it could serve as a lead compound for further drug development or as a tool in chemical biology. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C6H10N4O
InChI:InChI=1S/C6H10N4O/c1-11-6-9-8-5-4-7-2-3-10(5)6/h7H,2-4H2,1H3
InChI key:InChIKey=LJVHHHFNCBLTHO-UHFFFAOYSA-N
SMILES:O(C)C=1N2C(=NN1)CNCC2
Synonyms:- 1,2,4-Triazolo[4,3-a]pyrazine, 5,6,7,8-tetrahydro-3-methoxy-
- 3-Methoxy-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine
- 5,6,7,8-Tetrahydro-3-methoxy-1,2,4-triazolo[4,3-a]pyrazine
- 3-Methoxy-5H,6H,7H,8H-[1,2,4]triazolo[4,3-a]pyrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.