CAS 723294-74-4

3-Fluoro-5-iodobenzoic acid

Description:

3-Fluoro-5-iodobenzoic acid is an aromatic carboxylic acid characterized by the presence of both fluorine and iodine substituents on a benzene ring. Specifically, the fluorine atom is located at the meta position (3-position) and the iodine atom at the para position (5-position) relative to the carboxylic acid group. This compound exhibits typical properties of benzoic acids, including acidity due to the carboxylic group, which can donate a proton in solution. The presence of the electronegative fluorine and iodine atoms influences the compound's reactivity and polarity, potentially enhancing its ability to participate in electrophilic aromatic substitution reactions. Additionally, the molecular structure contributes to its unique physical properties, such as solubility in organic solvents and varying degrees of solubility in water, depending on the pH. 3-Fluoro-5-iodobenzoic acid may find applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis, owing to its functional groups and the ability to undergo further chemical transformations.

Formula: C₇H₄FIO₂

InChI: InChI=1S/C7H4FIO2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H,10,11)

InChI key: InChIKey=GYWJTQMNTRDRNA-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(F)=CC(I)=C1

Synonyms:

• 5-Fluoro-3-iodo-benzoic acid
• Benzoic acid, 3-fluoro-5-iodo-
• 3-Fluoro-5-iodobenzoic acid

5-Fluoro-3-iodobenzoic acid

CAS: 723294-74-4

Formula: C₇H₄FIO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 266.0083

Ref: IN-DA005I8O

3-Fluoro-5-iodobenzoic acid

CAS: 723294-74-4

3-Fluoro-5-iodobenzoic acid

Formula: C₇H₄FIO₂

Purity: ≥95%

Color and Shape: faint orange to faint red powder

Molecular weight: 266.01g/mol

Ref: 54-PC9102

3-Fluoro-5-iodobenzoic acid

CAS: 723294-74-4

Formula: C₇H₄FIO₂

Purity: 95%

Color and Shape: Powder

Molecular weight: 266.01

Ref: 10-F020053