CAS 7233-42-3

[2-[(E)-2-(2-aminoethylamino)ethyliminomethyl]phenyl]azanide; nickel

Description:

The chemical substance known as "[2-[(E)-2-(2-aminoethylamino)ethyliminomethyl]phenyl]azanide; nickel" with CAS number 7233-42-3 is a coordination complex that features a nickel ion coordinated to a ligand containing an amino group and an imine functional group. This compound typically exhibits characteristics associated with transition metal complexes, such as variable oxidation states, coordination geometries, and the ability to form chelate rings. The presence of amino groups suggests potential for biological activity, possibly influencing interactions with biomolecules. The ligand's structure indicates it may participate in hydrogen bonding and other non-covalent interactions, which can affect its solubility and stability in various solvents. Additionally, nickel complexes are often studied for their catalytic properties and potential applications in fields such as materials science and biochemistry. The specific properties, such as solubility, melting point, and reactivity, would depend on the precise conditions and environment in which the compound is analyzed.

Formula: C₁₁H₁₇N₄Ni

InChI: InChI=1/C11H17N4.Ni/c12-5-6-14-7-8-15-9-10-3-1-2-4-11(10)13;/h1-4,9,13-14H,5-8,12H2;/q-1;/b15-9+;