
CAS 723308-55-2
:Methyl 4-amino-1-(phenylmethyl)-3-piperidinecarboxylate
Description:
Methyl 4-amino-1-(phenylmethyl)-3-piperidinecarboxylate, identified by its CAS number 723308-55-2, is a chemical compound characterized by its piperidine structure, which includes a piperidine ring substituted with an amino group and a phenylmethyl group. This compound typically exhibits properties associated with both basic and aromatic functionalities, making it potentially useful in various chemical applications, including medicinal chemistry. The presence of the amino group suggests it may engage in hydrogen bonding, influencing its solubility and reactivity. Additionally, the ester functional group (methyl ester) can participate in nucleophilic reactions, which may be relevant in synthetic pathways. The compound's molecular structure indicates it may have biological activity, potentially serving as a scaffold for drug development. Its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, Methyl 4-amino-1-(phenylmethyl)-3-piperidinecarboxylate represents a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C14H20N2O2
InChI:InChI=1S/C14H20N2O2/c1-18-14(17)12-10-16(8-7-13(12)15)9-11-5-3-2-4-6-11/h2-6,12-13H,7-10,15H2,1H3
InChI key:InChIKey=FDAHYLITFOVURS-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1C(N)CCN(CC2=CC=CC=C2)C1
Synonyms:- Methyl 4-amino-1-(phenylmethyl)-3-piperidinecarboxylate
- 3-Piperidinecarboxylic acid, 4-amino-1-(phenylmethyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.