CAS 723332-65-8

4-Amino-2,4-dihydro-5-[(4-methoxyphenoxy)methyl]-3H-1,2,4-triazole-3-thione

Description:

4-Amino-2,4-dihydro-5-[(4-methoxyphenoxy)methyl]-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features an amino group, contributing to its potential as a biological active agent. The presence of a thione functional group (a sulfur analog of a ketone) enhances its reactivity and may influence its biological properties. The methoxyphenoxy methyl substituent suggests potential for interactions with biological targets, possibly enhancing solubility and bioavailability. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry and agricultural applications. Its CAS number, 723332-65-8, allows for precise identification in chemical databases. As with many triazole derivatives, it may also possess antifungal or herbicidal properties, although specific biological activities would require empirical investigation. Overall, the unique structural features of this compound position it as a candidate for further research in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₀H₁₂N₄O₂S

InChI: InChI=1S/C10H12N4O2S/c1-15-7-2-4-8(5-3-7)16-6-9-12-13-10(17)14(9)11/h2-5H,6,11H2,1H3,(H,13,17)

InChI key: InChIKey=KJLSUWJYBZBVIJ-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(OC)C=C1)C=2N(N)C(=S)NN2

Synonyms:

• 4-Amino-2,4-dihydro-5-[(4-methoxyphenoxy)methyl]-3H-1,2,4-triazole-3-thione
• 3H-1,2,4-Triazole-3-thione, 4-amino-2,4-dihydro-5-[(4-methoxyphenoxy)methyl]-

4-Amino-5-[(4-methoxyphenoxy)methyl]-4H-1,2,4-triazole-3-thiol

CAS: 723332-65-8

Versatile small molecule scaffold

Formula: C₁₀H₁₂N₄O₂S

Purity: Min. 95%

Molecular weight: 252.3 g/mol

Ref: 3D-YDB33265