CAS 72338-57-9

Ethyl 1H-imidazole-1-butanoate

Description:

Ethyl 1H-imidazole-1-butanoate, with the CAS number 72338-57-9, is an organic compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility in organic solvents and potential applications in various chemical reactions. Ethyl 1H-imidazole-1-butanoate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It exhibits moderate polarity due to the presence of both the imidazole and ester functionalities, which can influence its reactivity and interaction with biological systems. This compound may be of interest in medicinal chemistry and biochemistry, particularly in the development of pharmaceuticals or as a building block in organic synthesis. Its properties, such as boiling point, melting point, and specific reactivity, can vary based on the conditions and purity of the sample. As with many chemical substances, appropriate safety measures should be taken when handling it in laboratory settings.

Formula: C₉H₁₄N₂O₂

InChI: InChI=1/C9H14N2O2/c1-2-13-9(12)4-3-6-11-7-5-10-8-11/h5,7-8H,2-4,6H2,1H3

InChI key: InChIKey=RDNHWIOBCYOAMM-UHFFFAOYSA-N

SMILES: C(CCC(OCC)=O)N1C=CN=C1

Synonyms:

• 1H-Imidazole-1-butanoic acid, ethyl ester
• Ethyl 4-(imidazol-1-yl)butyrate
• Ethyl 1H-imidazole-1-butanoate