
CAS 72338-95-5
:2-Phenyl-1H-indol-4-ol
Description:
2-Phenyl-1H-indol-4-ol, with the CAS number 72338-95-5, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a hydroxyl group (-OH) at the 4-position of the indole ring and a phenyl group attached to the 2-position. It typically appears as a solid at room temperature and may exhibit a range of colors depending on its purity and specific form. The presence of the hydroxyl group contributes to its potential as a phenolic compound, influencing its solubility in polar solvents and its reactivity in various chemical reactions. 2-Phenyl-1H-indol-4-ol may also exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its properties, such as melting point, boiling point, and spectral characteristics, can vary based on the specific conditions and methods of synthesis. Overall, this compound is notable for its structural features and potential applications in various fields of research.
Formula:C14H11NO
InChI:InChI=1S/C14H11NO/c16-14-8-4-7-12-11(14)9-13(15-12)10-5-2-1-3-6-10/h1-9,15-16H
InChI key:InChIKey=QWGDBFAEHKZSGA-UHFFFAOYSA-N
SMILES:OC1=C2C=C(NC2=CC=C1)C3=CC=CC=C3
Synonyms:- 1H-Indol-4-ol, 2-phenyl-
- 2-Phenyl-1H-indol-4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.