CAS 7234-04-0
:1,2-Dihydro-1,2-dihydroxynaphthalene
Description:
1,2-Dihydro-1,2-dihydroxynaphthalene, with the CAS number 7234-04-0, is an organic compound that belongs to the naphthalene derivatives. This substance features a naphthalene backbone with two hydroxyl (-OH) groups and a saturated carbon-carbon bond, which distinguishes it from its fully aromatic counterparts. It typically appears as a colorless to pale yellow solid or liquid, depending on its purity and specific form. The presence of hydroxyl groups contributes to its solubility in polar solvents, while the naphthalene structure provides hydrophobic characteristics. This compound is of interest in various chemical applications, including organic synthesis and as an intermediate in the production of dyes and pharmaceuticals. Its reactivity is influenced by the functional groups present, allowing for further chemical modifications. Additionally, 1,2-Dihydro-1,2-dihydroxynaphthalene may exhibit antioxidant properties, making it relevant in studies related to biological systems and materials science. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C10H10O2
InChI:InChI=1S/C10H10O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6,9-12H
InChI key:InChIKey=QPUHWUSUBHNZCG-UHFFFAOYSA-N
SMILES:OC1C=2C(C=CC1O)=CC=CC2
Synonyms:- Naphthalene-1,2-dihydrodiol
- 1,2-Naphthalenediol, 1,2-dihydro-
- 1,2-Dihydronaphthalene-1,2-diol
- 1,2-naphthalenediol, 1,2-dihydro-
- 1,2-Dihydro-1,2-naphthalenediol
- 1,2-Dihydro-1,2-dihydroxynaphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.