CymitQuimica logo

CAS 72357-66-5

:

N-[2-(4-Pyridinyl)ethyl]guanidine

Description:
N-[2-(4-Pyridinyl)ethyl]guanidine, with the CAS number 72357-66-5, is a chemical compound characterized by its guanidine structure, which features a pyridine ring substituted with an ethyl group. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its polar functional groups. It exhibits basic properties due to the presence of the guanidine moiety, which can participate in hydrogen bonding and interact with various biological targets. The pyridine ring contributes to its aromatic character and can influence its reactivity and interaction with other molecules. N-[2-(4-Pyridinyl)ethyl]guanidine has been studied for its potential applications in pharmacology, particularly in the context of its effects on neurotransmitter systems and as a potential therapeutic agent. Its unique structure allows it to engage in various chemical reactions, making it of interest in medicinal chemistry and drug development. As with many guanidine derivatives, it may also exhibit biological activity, warranting further investigation into its mechanisms of action and potential uses.
Formula:C8H12N4
InChI:InChI=1S/C8H12N4/c9-8(10)12-6-3-7-1-4-11-5-2-7/h1-2,4-5H,3,6H2,(H4,9,10,12)
InChI key:InChIKey=CPCLSTYMYIGKFR-UHFFFAOYSA-N
SMILES:C(CNC(=N)N)C=1C=CN=CC1
Synonyms:
  • N-[2-(4-Pyridinyl)ethyl]guanidine
  • (2-Pyridin-4-yl-ethyl)-guanidine
  • Guanidine, N-[2-(4-pyridinyl)ethyl]-
  • Guanidine, [2-(4-pyridinyl)ethyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.