CymitQuimica logo

CAS 72357-67-6

:

1-(pyridin-3-ylmethyl)guanidine

Description:
1-(Pyridin-3-ylmethyl)guanidine, with the CAS number 72357-67-6, is an organic compound characterized by its guanidine structure, which is modified by the presence of a pyridine ring. This compound typically exhibits properties associated with both guanidine and pyridine functionalities, including potential basicity due to the guanidine moiety and aromatic characteristics from the pyridine. It is often used in medicinal chemistry and research due to its ability to interact with biological targets, potentially influencing various biochemical pathways. The presence of the pyridine ring can enhance lipophilicity, affecting its solubility and permeability in biological systems. Additionally, 1-(pyridin-3-ylmethyl)guanidine may exhibit specific pharmacological activities, making it of interest in drug development. Its synthesis usually involves the reaction of guanidine derivatives with pyridine-based reagents. As with many organic compounds, its stability, reactivity, and interactions can be influenced by environmental factors such as pH and temperature.
Formula:C7H10N4
InChI:InChI=1/C7H10N4/c8-7(9)11-5-6-2-1-3-10-4-6/h1-4H,5H2,(H4,8,9,11)
SMILES:c1cc(cnc1)CNC(=N)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.