CAS 7236-78-4

2-oxaspiro[4.5]decan-3-one

Description:

2-Oxaspiro[4.5]decan-3-one, with the CAS number 7236-78-4, is a bicyclic organic compound characterized by its unique spiro structure, which consists of a ketone functional group and an ether linkage. This compound features a ten-membered ring system that includes a carbonyl group at the 3-position and an oxygen atom incorporated into the spiro framework. The presence of the spiro arrangement contributes to its rigidity and can influence its reactivity and interaction with other molecules. Typically, compounds like 2-oxaspiro[4.5]decan-3-one exhibit interesting chemical properties, including potential applications in organic synthesis and medicinal chemistry due to their structural complexity. The compound may also display specific physical properties such as boiling and melting points, solubility in various solvents, and stability under different conditions, which are essential for its practical applications. Overall, the unique structural features of 2-oxaspiro[4.5]decan-3-one make it a subject of interest in various fields of chemical research.

Formula: C₉H₁₄O₂

InChI: InChI=1/C9H14O2/c10-8-6-9(7-11-8)4-2-1-3-5-9/h1-7H2

SMILES: C1CCC2(CC1)CC(=O)OC2

2-Oxaspiro[4.5]decan-3-one

Controlled Product

CAS: 7236-78-4

Applications γ-Butyrolactones derivative. Convulsant activity.

Formula: C₉H₁₄O₂

Color and Shape: Neat

Molecular weight: 154.21

Ref: TR-O845200

2-Oxaspiro[4.5]decan-3-one

CAS: 7236-78-4

2-Oxaspiro[4.5]decan-3-one is a chemical that is structurally related to the neurotransmitter gamma-aminobutyric acid (GABA). It has been shown to be an effective treatment for chronic pain, with a relatively low incidence of adverse effects. 2-Oxaspiro[4.5]decan-3-one inhibits the activity of protein kinase C, which may contribute to its analgesic effect. GABA receptors are present in the detrusor muscle and urethral sphincter, which may explain some of the drug's efficacy. 2-Oxaspiro[4.5]decan-3-one also binds to gabapentin binding sites on the alpha2 delta subunit of voltage dependent calcium channels and inhibits Ca2+ entry into cells, thereby reducing intracellular Ca2+ levels and lowering the excitability of neurons.

Formula: C₉H₁₄O₂

Purity: Min. 95%

Molecular weight: 154.21 g/mol

Ref: 3D-HAA23678