CAS 72370-19-5

5-(2-Bromoacetyl)-2-(phenylmethoxy)benzamide

Description:

5-(2-Bromoacetyl)-2-(phenylmethoxy)benzamide, with the CAS number 72370-19-5, is an organic compound characterized by its complex structure, which includes a benzamide core substituted with a bromoacetyl group and a phenylmethoxy moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the bromoacetyl group suggests that it may participate in nucleophilic substitution reactions, while the phenylmethoxy group can influence its electronic properties and steric hindrance. The compound may be of interest in medicinal chemistry due to its potential biological activity, as similar structures have been explored for their pharmacological properties. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Overall, this compound represents a unique combination of functional groups that may lend itself to various applications in research and development within the field of organic chemistry.

Formula: C₁₆H₁₄BrNO₃

InChI: InChI=1S/C16H14BrNO3/c17-9-14(19)12-6-7-15(13(8-12)16(18)20)21-10-11-4-2-1-3-5-11/h1-8H,9-10H2,(H2,18,20)

InChI key: InChIKey=LUQQESVFZAPODX-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C2=C(C(N)=O)C=C(C(CBr)=O)C=C2

Synonyms:

• 2-(Benzyloxy)-5-(2-bromoacetyl)benzamide
• 2-(Benzyloxy)-5-(Bromoacetyl)Benzamide
• 5-(2-Bromoacetyl)-2-(phenylmethoxy)benzamide
• Benzamide, 5-(2-bromoacetyl)-2-(phenylmethoxy)-
• Benzamide, 5-(bromoacetyl)-2-(phenylmethoxy)-

5-(2-Bromoacetyl)-2-(phenylmethoxy)benzamide

Controlled Product

CAS: 72370-19-5

Applications 5-(2-Bromoacetyl)-2-(phenylmethoxy)benzamide is an intermediate of (R,R)-Labetalol (L096500), a specific competitive antagonist at both α-and β-adrenergic receptor sites. (R,R)-Labetalol is used as an antihypertensive.

Formula: C₁₆H₁₄BrNO₃

Color and Shape: Neat

Molecular weight: 348.19

Ref: TR-B679310