CAS 72373-81-0
:methyl 2-fluoro-6-hydroxybenzoate
Description:
Methyl 2-fluoro-6-hydroxybenzoate, with the CAS number 72373-81-0, is an organic compound that belongs to the class of benzoates. It features a benzoic acid derivative where a methyl ester group is attached to the carboxylic acid, along with a hydroxy group and a fluorine atom at specific positions on the aromatic ring. This compound typically exhibits characteristics such as being a colorless to pale yellow liquid or solid, depending on its purity and form. It is generally soluble in organic solvents like ethanol and ether but may have limited solubility in water due to its hydrophobic aromatic structure. The presence of the hydroxy group contributes to its potential for hydrogen bonding, influencing its reactivity and interactions with other substances. Methyl 2-fluoro-6-hydroxybenzoate may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its functional groups that can participate in further chemical reactions. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C8H7FO3
InChI:InChI=1/C8H7FO3/c1-12-8(11)7-5(9)3-2-4-6(7)10/h2-4,10H,1H3
SMILES:COC(=O)c1c(cccc1O)F
Synonyms:- Benzoic acid, 2-fluoro-6-hydroxy-, methyl ester
- 2-Fluoro-6-hydroxybenzoicacid methyl ester
- Methyl 6-fluorosalicylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 2-fluoro-6-hydroxybenzoate
CAS:Formula:C8H7FO3Purity:98%Color and Shape:SolidMolecular weight:170.1378Methyl 2-fluoro-6-hydroxybenzoate
CAS:<p>Methyl 2-fluoro-6-hydroxybenzoate</p>Formula:C8H7FO3Purity:98%Color and Shape: clear. colourless liquidMolecular weight:170.14g/molMethyl 6-fluorosalicylate
CAS:Formula:C8H7FO3Purity:98%Color and Shape:Solid, Low Melting SolidMolecular weight:170.139Methyl 2-fluoro-6-hydroxybenzoate
CAS:<p>Methyl 2-fluoro-6-hydroxybenzoate is a colorless liquid that is soluble in water. It has a sulfur atom and two hydroxyl groups at the 2 and 6 positions on the benzene ring. This compound is an isotopologue of methyl 2,6-dihydroxybenzoate, which can be distinguished by deuterium labeling. At equilibrium, the tautomers are found in equal proportions. The hydrogen bond between the hydroxyl group at position 6 and the methyl group at position 2 plays a large role in determining the relative abundance of these tautomers. The equilibrium constant for this reaction is 1.01 x 10^9. Methyl 2-fluoro-6-hydroxybenzoate has been shown to have an isotope effect on its intermolecular interactions with other molecules, such as acceptors and donors, in solution.END>></p>Formula:C8H7FO3Purity:Min. 95%Molecular weight:170.14 g/mol
