CAS 723760-71-2
:6-Amino-5-bromo-2,3-dihydro-1H-inden-1-one
Description:
6-Amino-5-bromo-2,3-dihydro-1H-inden-1-one is an organic compound characterized by its unique bicyclic structure, which includes an indene core with specific functional groups. The presence of an amino group (-NH2) and a bromo substituent (-Br) contributes to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The compound's CAS number, 723760-71-2, allows for easy identification in chemical databases and literature. As with many brominated compounds, it may also exhibit unique properties related to its halogen content, such as increased lipophilicity or specific interactions with biological targets. Overall, 6-Amino-5-bromo-2,3-dihydro-1H-inden-1-one is a versatile compound with potential applications in synthetic organic chemistry and pharmaceuticals.
Formula:C9H8BrNO
InChI:InChI=1S/C9H8BrNO/c10-7-3-5-1-2-9(12)6(5)4-8(7)11/h3-4H,1-2,11H2
InChI key:InChIKey=JLJSHBWPQDKMRQ-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(Br)=C(N)C2)CC1
Synonyms:- 6-Amino-5-Bromo-2,3-Dihydro-1H-Inden-1-One
- 6-Amino-5-bromoindan-1-one
- 1H-Inden-1-one, 6-amino-5-bromo-2,3-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
