CAS 7238-61-1
:2-Bromo-4-methylthiazole
Description:
2-Bromo-4-methylthiazole is a heterocyclic organic compound characterized by the presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound features a bromine atom and a methyl group attached to the thiazole ring, specifically at the 2 and 4 positions, respectively. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. 2-Bromo-4-methylthiazole is known for its reactivity, particularly in nucleophilic substitution reactions due to the presence of the bromine atom, which can be displaced by various nucleophiles. It is utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, and other specialty chemicals. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry. As with many brominated compounds, it is important to handle 2-Bromo-4-methylthiazole with care due to potential toxicity and environmental concerns.
Formula:C11H13IN4O3
InChI:InChI=1/C11H13IN4O3/c12-5-2-16(8-1-6(18)7(3-17)19-8)11-9(5)10(13)14-4-15-11/h2,4,6-8,17-18H,1,3H2,(H2,13,14,15)
SMILES:C1C(C(CO)OC1n1cc(c2c(N)ncnc12)I)O
Synonyms:- 2-Bromo-4-methyl-1,3-thiazole
- 7-(2-deoxypentofuranosyl)-5-iodo-7H-pyrrolo[2,3-d]pyrimidin-4-aminato(2-)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Bromo-4-methylthiazole
CAS:Formula:C4H4BrNSPurity:95%Color and Shape:LiquidMolecular weight:178.05032-Bromo-4-methyl-1,3-thiazole
CAS:2-Bromo-4-methyl-1,3-thiazoleFormula:C4H4BrNSPurity:≥95%Color and Shape:LiquidMolecular weight:178.05g/mol2-Bromo-4-methylthiazole
CAS:Controlled ProductApplications 2-Bromo-4-methylthiazole
Formula:C4H4BrNSColor and Shape:NeatMolecular weight:178.052-Bromo-4-methyl-1,3-thiazole
CAS:2-Bromo-4-methyl-1,3-thiazole is a diazotization agent that reacts with nitrogen and forms a terminal nitro group. This reaction system is used in the formation of diazo compounds and the synthesis of dyes. 2-Bromo-4-methyl-1,3-thiazole can be used to generate nitrogen oxide, which is a precursor for the manufacture of various types of nitro compounds. It also reacts with metal oxides to produce metal nitrates.Purity:Min. 95%





