CAS 72389-06-1

3,10,12-trihydroxy-2-methoxy-3-methyl-4,6,11-trioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 6-deoxy-2-O-methylhexopyranoside

Description:

3,10,12-trihydroxy-2-methoxy-3-methyl-4,6,11-trioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 6-deoxy-2-O-methylhexopyranoside is a complex organic compound characterized by its intricate molecular structure, which includes multiple hydroxyl groups, a methoxy group, and a hexopyranoside moiety. This compound features a tetracene backbone, which contributes to its potential applications in organic electronics and photonics due to its extended π-conjugation. The presence of hydroxyl groups suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The methoxy group can enhance lipophilicity, potentially affecting its biological activity and interaction with cellular systems. Additionally, the 6-deoxy-2-O-methylhexopyranoside component indicates that this compound may have glycosidic properties, which could be relevant in biochemical contexts, such as enzyme interactions or as a substrate in glycosylation reactions. Overall, the unique combination of functional groups and structural features positions this compound as a subject of interest in both synthetic and medicinal chemistry.

Formula: C₂₇H₂₈O₁₂

InChI: InChI=1/C27H28O12/c1-9-17(29)21(33)23(36-3)26(38-9)39-22-16-12(24(34)27(2,35)25(22)37-4)8-11-15(20(16)32)19(31)14-10(18(11)30)6-5-7-13(14)28/h5-9,17,21-23,25-26,28-29,32-33,35H,1-4H3

SMILES: CC1C(C(C(C(O1)OC1c2c(cc3c(C(=O)c4c(cccc4O)C3=O)c2O)C(=O)C(C)(C1OC)O)OC)O)O

Aranciamycin

CAS: 72389-06-1

Formula: C₂₇H₂₈O₁₂

Purity: 86.83%

Color and Shape: Brown. Solid

Molecular weight: 545.0

Ref: 8R-CL0368

Aranciamycin

CAS: 72389-06-1

Formula: C₂₇H₂₈O₁₂

Molecular weight: 544.5

Ref: 7W-GA1926

4-(4,5-Dihydroxy-3-methoxy-6-methyloxan-2-yl)oxy-2,5,7-trihydroxy-3-methoxy-2-methyl-3,4-dihydrotetracene-1,6,11-trione

CAS: 72389-06-1

4-(4,5-Dihydroxy-3-methoxy-6-methyloxan-2-yl)oxy-2,5,7-trihydroxy-3-methoxy-2-methyl-3,4-dihydrotetracene-1,6,11-trione is an anthraquinone derivative, which is a specialized organic compound. This compound is typically derived from complex synthetic processes involving multi-step organic reactions starting from anthraquinone precursors. Its mode of action primarily involves the disruption of microbial cell walls and the inhibition of essential enzymatic pathways that are critical for microbial replication and survival.

Formula: C₂₇H₂₈O₁₂

Purity: Min. 95%

Molecular weight: 544.5 g/mol

Ref: 3D-XCA38906

Aranciamycin

CAS: 72389-06-1

Aranciamycin (Compound 1), an anthracycline antibiotic, exhibits collagenase inhibitory activity (IC50 3.7*10^-7 M) and can inhibit DNA synthesis in tumor cells

Formula: C₂₇H₂₈O₁₂

Color and Shape: Solid

Molecular weight: 544.5

Ref: TM-T82975