CAS 7239-48-7
:hexa-2,4-diyne-1,6-diyl bis(4-bromobenzenesulfonate)
Description:
Hexa-2,4-diyne-1,6-diyl bis(4-bromobenzenesulfonate) is an organic compound characterized by its unique structure, which includes a hexa-2,4-diyne backbone and two 4-bromobenzenesulfonate groups. This compound features multiple triple bonds, contributing to its reactivity and potential applications in organic synthesis and materials science. The presence of the sulfonate groups enhances its solubility in polar solvents and may facilitate ionic interactions, making it useful in various chemical reactions. The bromine atoms in the sulfonate groups can also serve as leaving groups in nucleophilic substitution reactions. Additionally, the compound's structure suggests potential for polymerization or cross-linking reactions, which could be exploited in the development of advanced materials. Its CAS number, 7239-48-7, allows for easy identification in chemical databases. Overall, hexa-2,4-diyne-1,6-diyl bis(4-bromobenzenesulfonate) is a versatile compound with significant implications in synthetic chemistry and material development.
Formula:C18H12Br2O6S2
InChI:InChI=1/C18H12Br2O6S2/c19-15-5-9-17(10-6-15)27(21,22)25-13-3-1-2-4-14-26-28(23,24)18-11-7-16(20)8-12-18/h5-12H,13-14H2
SMILES:C(#CCOS(=O)(=O)c1ccc(cc1)Br)C#CCOS(=O)(=O)c1ccc(cc1)Br
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Colistin B Pentatrifluoroacetate (Polymyxin E2 Pentatrifluoroacetate)
CAS:Formula:C52H98N16O13·5C2HF3O2Molecular weight:1155.46 5*114.02Polymyxin E2 sulfate
CAS:Polymyxin E2 sulfate is a cyclic polypeptide antibiotic, which is derived from the bacterium *Paenibacillus polymyxa*. This compound acts by disrupting the bacterial cell membrane, specifically interacting with the lipopolysaccharides and phospholipids in the outer membrane, leading to increased permeability and eventual cell death. It primarily targets gram-negative bacteria, making it effective against a range of pathogens responsible for serious infections.
Formula:C52H98N16O13Purity:Min. 95%Molecular weight:1,155.4 g/mol


