CAS 72396-01-1
:(1S,4aR,7R,7aR)-4-formyl-4a-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-yl beta-D-glucopyranoside
Description:
The chemical substance known as "(1S,4aR,7R,7aR)-4-formyl-4a-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-yl beta-D-glucopyranoside," with the CAS number 72396-01-1, is a complex organic compound characterized by its unique bicyclic structure and the presence of multiple functional groups. It features a hexahydrocyclopentapyran core, which contributes to its stereochemistry and potential biological activity. The presence of a formyl group and a hydroxyl group indicates that it may participate in various chemical reactions, such as oxidation or condensation. Additionally, the beta-D-glucopyranoside moiety suggests that this compound may exhibit glycosidic properties, potentially influencing its solubility and interaction with biological systems. Such compounds are often of interest in medicinal chemistry and natural product synthesis due to their structural complexity and potential pharmacological effects. Overall, this substance exemplifies the intricate relationship between molecular structure and biological function in organic chemistry.
Formula:C16H24O9
InChI:InChI=1/C16H24O9/c1-7-2-3-16(22)8(4-17)6-23-14(10(7)16)25-15-13(21)12(20)11(19)9(5-18)24-15/h4,6-7,9-15,18-22H,2-3,5H2,1H3/t7-,9-,10+,11-,12+,13-,14+,15+,16+/m1/s1
Synonyms:- Cyclopenta(c)pyran-4-carboxaldehyde, 1-(beta-D-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-4a-hydroxy-7-methyl-, (1S,4aR,7R,7aR)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Yuheinoside
CAS:Yuheinoside is a natural product from Pedicularis cephalantha.Formula:C16H24O9Purity:98%Color and Shape:SolidMolecular weight:360.36Plantarenaloside
CAS:Plantarenaloside is a glycoside compound, derived primarily from plant sources. This bioactive component is typically extracted from certain medicinal plants known for their therapeutic properties. As a glycoside, Plantarenaloside operates through its ability to release biologically active aglycones upon enzymatic hydrolysis. This mode of action allows it to engage in specific biochemical interactions within biological systems, which may influence various cellular processes.
Formula:C16H24O9Purity:Min. 95%Color and Shape:SolidMolecular weight:360.36 g/mol






