CAS 72398-31-3
:9-(2-deoxypentofuranosyl)-1-methyl-1,9-dihydro-6H-purin-6-one
Description:
The chemical substance known as "9-(2-deoxypentofuranosyl)-1-methyl-1,9-dihydro-6H-purin-6-one," with the CAS number 72398-31-3, is a nucleoside analog that features a purine base structure. This compound is characterized by the presence of a 2-deoxypentofuranosyl sugar moiety, which is a five-carbon sugar lacking an oxygen atom at the second carbon, making it a component of DNA rather than RNA. The purine base is modified with a methyl group at the nitrogen position, contributing to its unique properties. This structure allows it to participate in various biochemical processes, potentially influencing nucleic acid synthesis and function. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of antiviral or anticancer agents. Its solubility, stability, and reactivity can vary based on environmental conditions, which are critical for its application in biological systems. Overall, this substance represents a significant area of study in medicinal chemistry and molecular biology.
Formula:C11H14N4O4
InChI:InChI=1/C11H14N4O4/c1-14-4-13-10-9(11(14)18)12-5-15(10)8-2-6(17)7(3-16)19-8/h4-8,16-17H,2-3H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N1-Methyl-2'-deoxyinosine
CAS:N1-Methyl-2'-deoxyinosine is a Nucleoside Derivative - N-Alkylated nucleoside.Formula:C11H14N4O4Color and Shape:SolidMolecular weight:266.25
