
CAS 72402-00-7
:Plinol
Description:
Plinol, with the CAS number 72402-00-7, is a chemical substance that is primarily known for its use as a surfactant and emulsifier in various industrial applications. It is characterized by its ability to reduce surface tension, which facilitates the mixing of water with oils and other hydrophobic substances. This property makes Plinol valuable in formulations such as detergents, cosmetics, and personal care products. Additionally, Plinol may exhibit good stability under a range of pH conditions and temperatures, enhancing its utility in diverse formulations. Its molecular structure typically includes hydrophilic and hydrophobic segments, allowing it to interact effectively with both polar and non-polar substances. Safety data sheets and regulatory information should be consulted for specific handling and safety guidelines, as with any chemical substance. Overall, Plinol serves as an important component in enhancing the performance and stability of various products across multiple industries.
Formula:C10H18O
InChI:InChI=1S/C10H18O/c1-7(2)9-5-6-10(4,11)8(9)3/h8-9,11H,1,5-6H2,2-4H3
InChI key:InChIKey=ZRVPDCMGGOSDKG-UHFFFAOYSA-N
SMILES:C(C)(=C)C1C(C)C(C)(O)CC1
Synonyms:- Plinol
- Cyclopentanol, 1,2-dimethyl-3-(1-methylethenyl)-
- 1,2-Dimethyl-3-(prop-1-en-2-yl)cyclopentan-1-ol
- Cyclopentanol, 3-isopropenyl-1,2-dimethyl-
- 1,2-Dimethyl-3-(1-methylethenyl)cyclopentanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.