CAS 72402-53-0
:(8α,9R)-(±)-6′-Methoxycinchonan-9-ol
Description:
(8α,9R)-(±)-6′-Methoxycinchonan-9-ol is a chemical compound belonging to the class of cinchona alkaloids, which are derived from the bark of the cinchona tree. This substance features a complex bicyclic structure that includes a methoxy group and a hydroxyl group, contributing to its unique chemical properties. The presence of these functional groups can influence its solubility, reactivity, and potential biological activity. The stereochemistry indicated by the (8α,9R) designation suggests specific spatial arrangements of atoms, which can significantly affect the compound's pharmacological effects. Compounds in this class are often studied for their potential use in medicinal chemistry, particularly in the development of antimalarial and analgesic agents. Additionally, the compound's CAS number, 72402-53-0, serves as a unique identifier for regulatory and research purposes. Overall, (8α,9R)-(±)-6′-Methoxycinchonan-9-ol exemplifies the intricate relationship between molecular structure and biological activity in organic chemistry.
Formula:C20H24N2O2
InChI:InChI=1/C20H24N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/t13-,14-,19-,20+/s2
InChI key:InChIKey=LOUPRKONTZGTKE-GZJAXPACNA-N
SMILES:[C@@H](O)(C=1C2=C(C=CC(OC)=C2)N=CC1)[C@]3([N@@]4C[C@H](C=C)[C@](C3)(CC4)[H])[H]
Synonyms:- (8α,9R)-(±)-6′-Methoxycinchonan-9-ol
- Cinchonan-9-ol, 6′-methoxy-, (8α,9R)-(±)-
- (±)-Quinine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
