CAS 7242-16-2

N-(4-Chlorophenyl)maleamic acid

Description:

N-(4-Chlorophenyl)maleamic acid is an organic compound characterized by its maleamic acid structure, which features a maleic acid backbone modified with a 4-chlorophenyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in pharmaceuticals and agrochemicals due to its ability to participate in various chemical reactions. The presence of the chlorophenyl group can influence its solubility, reactivity, and biological activity. N-(4-Chlorophenyl)maleamic acid may also display specific functional properties, such as acidity due to the carboxylic acid group, and it can engage in hydrogen bonding, which affects its interactions in biological systems. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, N-(4-Chlorophenyl)maleamic acid is of interest in synthetic chemistry and medicinal chemistry for its potential utility in developing new therapeutic agents.

Formula: C₁₀H₈ClNO₃

InChI: InChI=1/C10H8ClNO3/c11-7-1-3-8(4-2-7)12-9(13)5-6-10(14)15/h1-6H,(H,12,13)(H,14,15)/b6-5-

SMILES: c1cc(ccc1Cl)NC(=O)/C=C\C(=O)O

Synonyms:

• (2Z)-4-[(4-chlorophenyl)amino]-4-oxobut-2-enoic acid
• N-(4-Chlorophenyl)maleamic acid

(2E)-4-[(4-Chlorophenyl)amino]-4-oxobut-2-enoic acid

CAS: 7242-16-2

Formula: C₁₀H₈ClNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 225.6284

Ref: IN-DA00FACW

(Z)-4-((4-Chlorophenyl)amino)-4-oxobut-2-enoic acid

CAS: 7242-16-2

(Z)-4-((4-Chlorophenyl)amino)-4-oxobut-2-enoic acid

Purity: 95%

Molecular weight: 225.63g/mol

Ref: 54-OR1052485