CAS 7244-82-8
:3-(ethylsulfanyl)propanoic acid
Description:
3-(Ethylsulfanyl)propanoic acid, with the CAS number 7244-82-8, is an organic compound characterized by the presence of a propanoic acid backbone substituted with an ethylsulfanyl group at the third carbon position. This compound features a carboxylic acid functional group (-COOH), which imparts acidic properties, allowing it to donate protons in solution. The ethylsulfanyl group (-S-ethyl) contributes to the compound's unique reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of sulfur in the structure can influence the compound's polarity and solubility in various solvents. Additionally, the compound may exhibit specific biological activities, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding and van der Waals forces, which can affect its physical properties such as melting point and boiling point. Overall, 3-(ethylsulfanyl)propanoic acid is a versatile compound with potential applications in various fields of chemistry.
Formula:C5H10O2S
InChI:InChI=1/C5H10O2S/c1-2-8-4-3-5(6)7/h2-4H2,1H3,(H,6,7)
SMILES:CCSCCC(=O)O
Synonyms:- Propanoic Acid, 3-(Ethylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
