CAS 724424-43-5

Benzamide, 2-chloro-5-[4,5-dihydro-4-[(R)-hydroxymethoxymethyl]-3,5-dioxo-1,2,4-triazin-2(3H)-yl]-N-[(1-hydroxycycloheptyl)methyl]-

Description:

Benzamide, 2-chloro-5-[4,5-dihydro-4-[(R)-hydroxymethoxymethyl]-3,5-dioxo-1,2,4-triazin-2(3H)-yl]-N-[(1-hydroxycycloheptyl)methyl]- (CAS 724424-43-5) is a complex organic compound characterized by its unique structural features, including a benzamide core and multiple functional groups. The presence of a chloro substituent and a triazine ring contributes to its potential biological activity. The compound exhibits solubility in polar solvents due to the hydroxymethyl and hydroxy groups, which can engage in hydrogen bonding. Its molecular structure suggests potential interactions with biological targets, making it of interest in pharmaceutical research. The compound's stability and reactivity can be influenced by the presence of the dioxo groups and the cyclic hydroxyalkyl moiety, which may affect its pharmacokinetic properties. Overall, this compound's intricate design positions it as a candidate for further investigation in medicinal chemistry, particularly in the development of therapeutics targeting specific biological pathways.

Formula: C₂₀H₂₅ClN₄O₆

InChI: InChI=1/C20H25ClN4O6/c1-31-19(29)24-16(26)11-23-25(18(24)28)13-6-7-15(21)14(10-13)17(27)22-12-20(30)8-4-2-3-5-9-20/h6-7,10-11,19,29-30H,2-5,8-9,12H2,1H3,(H,22,27)/t19-/m1/s1

SMILES: CO[C@H](n1c(=O)cnn(c2ccc(c(c2)C(=NCC2(CCCCCC2)O)O)Cl)c1=O)O

CE-224535

CAS: 724424-43-5

CE-224535

Purity: ≥98%

Molecular weight: 480.94g/mol

Ref: 54-BUP12541

CE-224535

Controlled Product

CAS: 724424-43-5

Formula: C₂₂H₂₉ClN₄O₆

Color and Shape: Neat

Molecular weight: 480.942

Ref: TR-C255005

CE 224535

CAS: 724424-43-5

Antagonist of purinoreceptor P2X7

Formula: C₂₂H₂₉ClN₄O₆

Purity: Min. 95%

Molecular weight: 480.94 g/mol

Ref: 3D-FC158497

CE-224535

CAS: 724424-43-5

CE-224535 (PF-04905428) is a selective antagonist of P2X7 receptor. CE-224535 can be used in disease-modifying antirheumatic studies.

Formula: C₂₂H₂₉ClN₄O₆

Purity: 99.68%

Color and Shape: Solid

Molecular weight: 480.94

Ref: TM-T14920