CAS 72448-92-1
:ethyl (E)-6-chlorohex-2-enoate
Description:
Ethyl (E)-6-chlorohex-2-enoate is an organic compound characterized by its ester functional group, which is derived from the reaction of an alcohol (ethanol) and a carboxylic acid. This compound features a double bond in its carbon chain, specifically at the second carbon, indicating it is an unsaturated compound. The presence of the chlorine atom at the sixth carbon position contributes to its reactivity and potential applications in organic synthesis. The (E) configuration denotes the specific geometric arrangement of substituents around the double bond, which can influence the compound's physical and chemical properties, such as boiling point and reactivity. Ethyl (E)-6-chlorohex-2-enoate is typically a colorless to pale yellow liquid with a fruity odor, and it is soluble in organic solvents. It may be used in various chemical reactions, including as an intermediate in the synthesis of more complex molecules. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C8H13ClO2
InChI:InChI=1/C8H13ClO2/c1-2-11-8(10)6-4-3-5-7-9/h4,6H,2-3,5,7H2,1H3/b6-4+
Synonyms:- 2-Hexenoic acid, 6-chloro-, ethyl ester, (2E)-
- Ethyl (2E)-6-chlorohex-2-enoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
