CAS 72456-59-8

N-[4-(4-chlorophenyl)butyl]-N-ethylheptan-1-amine

Description:

N-[4-(4-chlorophenyl)butyl]-N-ethylheptan-1-amine, with the CAS number 72456-59-8, is a chemical compound that belongs to the class of amines. This substance features a complex structure characterized by a heptane backbone, which is substituted with an ethyl group and a butyl chain that is further substituted with a 4-chlorophenyl group. The presence of the chlorophenyl moiety suggests potential applications in medicinal chemistry, possibly as a pharmaceutical agent or in research settings. The amine functional group indicates that it may exhibit basic properties and could participate in various chemical reactions, such as alkylation or acylation. Additionally, the compound's hydrophobic characteristics, due to the long carbon chains, may influence its solubility and bioavailability. Safety and handling precautions should be observed, as with many amines, due to potential toxicity and reactivity. Overall, this compound's unique structure may provide interesting avenues for further study in organic synthesis and pharmacology.

Formula: C₁₉H₃₂ClN

InChI: InChI=1/C19H32ClN/c1-3-5-6-7-9-16-21(4-2)17-10-8-11-18-12-14-19(20)15-13-18/h12-15H,3-11,16-17H2,1-2H3

Synonyms:

• Benzenebutanamine, 4-chloro-N-ethyl-N-heptyl-

LY 97119

CAS: 72456-59-8

LY 97119, an analog of clofilium, inhibits heart potassium channels.

Formula: C₁₉H₃₂ClN

Purity: 98%

Color and Shape: Solid

Molecular weight: 309.92

Ref: TM-T27926