CAS 72458-42-5

(2R,3R,4R,5S)-1-ethyl-2-(hydroxymethyl)piperidine-3,4,5-triol

Description:

The chemical substance known as (2R,3R,4R,5S)-1-ethyl-2-(hydroxymethyl)piperidine-3,4,5-triol, with the CAS number 72458-42-5, is a piperidine derivative characterized by its specific stereochemistry, indicated by the R and S configurations at various carbon centers. This compound features a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and is substituted with an ethyl group and a hydroxymethyl group, contributing to its functional properties. The presence of multiple hydroxyl (-OH) groups makes it a polyol, which can enhance its solubility in water and its potential for hydrogen bonding. The stereochemistry of the molecule suggests that it may exhibit specific biological activities or interactions, as the spatial arrangement of atoms can significantly influence the behavior of organic compounds in biological systems. Overall, this compound may be of interest in medicinal chemistry and biochemistry due to its structural features and potential applications in drug development or as a biochemical tool.

Formula: C₈H₁₇NO₄

InChI: InChI=1/C8H17NO4/c1-2-9-3-6(11)8(13)7(12)5(9)4-10/h5-8,10-13H,2-4H2,1H3/t5-,6+,7-,8-/m1/s1

Synonyms:

• 3,4,5-Piperidinetriol, 1-ethyl-2-(hydroxymethyl)-, (2R,3R,4R,5S)-

N-Ethyldeoxynojirimycin hydrochloride

CAS: 72458-42-5

Ref: 7W-GC6301