CAS 72459-46-2

1-(4-bromobenzyl)-1H-imidazole

Description:

1-(4-Bromobenzyl)-1H-imidazole is an organic compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of the 4-bromobenzyl group enhances its reactivity and solubility in organic solvents. This compound typically exhibits properties such as moderate to high melting and boiling points, depending on its purity and crystalline form. It is often used in medicinal chemistry and pharmaceutical research due to its potential biological activity, including antimicrobial and antifungal properties. The bromine substituent can also facilitate further chemical modifications, making it a versatile intermediate in organic synthesis. Additionally, the compound may exhibit fluorescence, which can be useful in various analytical applications. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 1-(4-bromobenzyl)-1H-imidazole is a significant compound in the field of organic chemistry with various applications in research and development.

Formula: C₁₀H₉BrN₂

InChI: InChI=1/C10H9BrN2/c11-10-3-1-9(2-4-10)7-13-6-5-12-8-13/h1-6,8H,7H2

SMILES: c1cc(ccc1Cn1ccnc1)Br

Synonyms:

• 1H-imidazole, 1-[(4-bromophenyl)methyl]-

1-(4-Bromobenzyl)-1H-imidazole

CAS: 72459-46-2

Formula: C₁₀H₉BrN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 237.0959

Ref: IN-DA00FBTQ

1-(4-Bromobenzyl)-1H-imidazole

CAS: 72459-46-2

1-(4-Bromobenzyl)-1H-imidazole

Purity: 95%

Molecular weight: 237.10g/mol

Ref: 54-OR9183

1-(4-Bromobenzyl)imidazole

CAS: 72459-46-2

Formula: C₁₀H₉BrN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 237.1

Ref: 10-F226647

1-(4-Bromobenzyl)-1H-imidazole

CAS: 72459-46-2

1-(4-Bromobenzyl)-1H-imidazole is a compound that binds to the active site of enzymes and inhibits their activity. It is used as a research tool in molecular modeling, pharmacokinetics, and cancer chemotherapy. 1-(4-Bromobenzyl)-1H-imidazole has been shown to inhibit the growth of prostate cancer cells by inhibiting testosterone levels and also to be effective against leukemia cells. The drug has been shown to be a potent inhibitor of recombinant human catalysis with an IC50 value of 1 nM. This inhibition may be due to its ability to form a triazolium ring, which inhibits the enzymatic activity of catechol oxidase.

Formula: C₁₀H₉BrN₂

Purity: Min. 95%

Molecular weight: 237.1 g/mol

Ref: 3D-XCA45946