CAS 72459-53-1

2-[2-(1H-imidazol-1-yl)ethyl]-1H-isoindole-1,3(2H)-dione

Description:

2-[2-(1H-imidazol-1-yl)ethyl]-1H-isoindole-1,3(2H)-dione, with the CAS number 72459-53-1, is a chemical compound characterized by its unique structure that combines an isoindole moiety with an imidazole group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to the presence of the imidazole ring, which is known for its role in biological systems, particularly in enzyme catalysis and as a building block in pharmaceuticals. The isoindole structure contributes to its stability and may influence its reactivity and interaction with biological targets. Additionally, compounds of this nature are often investigated for their potential therapeutic applications, including antimicrobial and anticancer activities. The presence of both the imidazole and isoindole functionalities suggests that this compound may participate in hydrogen bonding and π-π stacking interactions, which are crucial for biological activity and molecular recognition processes. Overall, this compound represents a class of heterocyclic compounds with diverse applications in medicinal chemistry.

Formula: C₁₃H₁₁N₃O₂

InChI: InChI=1/C13H11N3O2/c17-12-10-3-1-2-4-11(10)13(18)16(12)8-7-15-6-5-14-9-15/h1-6,9H,7-8H2

Synonyms:

• 2-[2-(1H-Imidazol-1-yl)ethyl]-1H-isoindole-1,3(2H)-dione
• 1H-isoindole-1,3(2H)-dione, 2-[2-(1H-imidazol-1-yl)ethyl]-