
CAS 72467-44-8
:Piclonidine
Description:
Piclonidine is a chemical compound classified as an antihypertensive agent, primarily used for the treatment of high blood pressure. It acts as a centrally acting alpha-2 adrenergic agonist, which means it stimulates alpha-2 receptors in the brain, leading to a decrease in sympathetic outflow and a subsequent reduction in blood pressure. The molecular structure of piclonidine includes a piperidine ring, contributing to its pharmacological properties. It is typically administered orally and is known for its relatively rapid onset of action. In terms of safety and side effects, common adverse reactions may include sedation, dry mouth, and potential cardiovascular effects. Piclonidine's efficacy and safety profile make it a valuable option in managing hypertension, particularly in patients who may benefit from a centrally acting mechanism. As with any medication, it is essential for healthcare providers to consider individual patient factors when prescribing piclonidine.
Formula:C14H17Cl2N3O
InChI:InChI=1S/C14H17Cl2N3O/c15-10-4-3-5-11(16)13(10)19(14-17-7-8-18-14)12-6-1-2-9-20-12/h3-5,12H,1-2,6-9H2,(H,17,18)
InChI key:InChIKey=NYQGJEQCYOJBPV-UHFFFAOYSA-N
SMILES:N(C1=C(Cl)C=CC=C1Cl)(C=2NCCN2)C3CCCCO3
Synonyms:- 1H-Imidazol-2-amine, N-(2,6-dichlorophenyl)-4,5-dihydro-N-(tetrahydro-2H-pyran-2-yl)-
- N-(2,6-Dichlorophenyl)-4,5-dihydro-N-(tetrahydro-2H-pyran-2-yl)-1H-imidazol-2-amine
- Piclonidine
- LR 99853
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Piclonidine
CAS:<p>Piclonidine is a bioactive chemical.</p>Formula:C14H17Cl2N3OColor and Shape:SolidMolecular weight:314.21
