CAS 72468-95-2

1-Chloro-3-(cyclopentyloxy)-2-propanol

Description:

1-Chloro-3-(cyclopentyloxy)-2-propanol is an organic compound characterized by its unique structure, which includes a chloro group and a cyclopentyloxy moiety attached to a propanol backbone. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents, reflecting its polar nature due to the presence of the hydroxyl (-OH) group. The chloro substituent introduces reactivity, making it a potential intermediate in organic synthesis, particularly in the formation of other chemical entities through nucleophilic substitution reactions. The cyclopentyloxy group contributes to the compound's hydrophobic characteristics, influencing its solubility and reactivity. Additionally, the presence of both the chloro and hydroxyl groups can impart interesting biological activities, making it a subject of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 1-Chloro-3-(cyclopentyloxy)-2-propanol is a versatile compound with potential applications in various chemical syntheses and research fields.

Formula: C₈H₁₅ClO₂

InChI: InChI=1S/C8H15ClO2/c9-5-7(10)6-11-8-3-1-2-4-8/h7-8,10H,1-6H2

InChI key: InChIKey=QABUJFBREIITHS-UHFFFAOYSA-N

SMILES: O(CC(CCl)O)C1CCCC1

Synonyms:

• 1-Chloro-3-(cyclopentyloxy)-2-propanol
• 2-Propanol, 1-chloro-3-(cyclopentyloxy)-