CAS 724711-21-1

2-[2-(quinolin-3-yl)pyridin-4-yl]-1,5,6,7-tetrahydro-4H-pyrrolo[3,2-c]pyridin-4-one

Description:

The chemical substance known as 2-[2-(quinolin-3-yl)pyridin-4-yl]-1,5,6,7-tetrahydro-4H-pyrrolo[3,2-c]pyridin-4-one, with the CAS number 724711-21-1, is a complex organic compound characterized by its multi-cyclic structure, which includes both pyridine and quinoline moieties. This compound features a tetrahydropyrrolo structure, contributing to its potential biological activity. It is typically synthesized through multi-step organic reactions, which may involve the formation of various heterocycles. The presence of nitrogen atoms in its structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular conformation. Additionally, compounds of this nature may exhibit properties such as fluorescence or specific binding affinities, which can be explored in various applications, including drug discovery and development. Further studies would be necessary to fully elucidate its pharmacological profile and potential therapeutic uses.

Formula: C₂₁H₁₆N₄O

InChI: InChI=1/C21H16N4O/c26-21-16-11-20(25-18(16)6-8-23-21)14-5-7-22-19(10-14)15-9-13-3-1-2-4-17(13)24-12-15/h1-5,7,9-12,25H,6,8H2,(H,23,26)

SMILES: c1ccc2c(c1)cc(cn2)c1cc(ccn1)c1cc2c(CCN=C2O)[nH]1

MK2 Inhibitor III

CAS: 724711-21-1

Formula: C₂₁H₁₆N₄O

Purity: 99%

Color and Shape: Solid

Molecular weight: 340.3779

Ref: IN-DA01CBK3

MK2-IN-3

CAS: 724711-21-1

MK2-IN-3

Purity: ≥98%

Molecular weight: 340.38g/mol

Ref: 54-BUP08272

2-(2-(Quinolin-3-Yl)Pyridin-4-Yl)-6,7-Dihydro-1H-Pyrrolo[3,2-C]Pyridin-4(5H)-One

CAS: 724711-21-1

2-(2-(Quinolin-3-Yl)Pyridin-4-Yl)-6,7-Dihydro-1H-Pyrrolo[3,2-C]Pyridin-4(5H)-One

Purity: 98%

Molecular weight: 340.38g/mol

Ref: 54-OR1022990

MK2-IN-3

CAS: 724711-21-1

MK2-IN-3 is a potent MK-2 inhibitor, cell-permeable, for rheumatoid arthritis treatment.

Formula: C₂₁H₁₆N₄O

Purity: 99.01%

Color and Shape: Solid

Molecular weight: 340.38

Ref: TM-T9034

2-(2-(Quinolin-3-yl)pyridin-4-yl)-6,7-dihydro-1H-pyrrolo[3,2-c]pyridin-4(5H)-one

CAS: 724711-21-1

Purity: 98+%

Molecular weight: 340.385986328125

Ref: 10-F869389

MK2 Inhibitor III

Controlled Product

CAS: 724711-21-1

Formula: C₂₁H₁₆N₄O

Color and Shape: Neat

Molecular weight: 340.38

Ref: TR-M424495

Mk2 inhibitor III

CAS: 724711-21-1

MK2 Inhibitor III is a pharmacological agent, specifically a selective inhibitor, that intervenes in the MAPKAPK2 (MK2) signaling pathway. It is derived through chemical synthesis, designed to obstruct the activity of the mitogen-activated protein kinase-activated protein kinase 2 (MK2). This inhibition occurs through competitive binding at the ATP-binding site of MK2, effectively reducing the activity of this kinase involved in the stress response pathway.

Formula: C₂₁H₁₆N₄O

Purity: Min. 95%

Molecular weight: 340.4 g/mol

Ref: 3D-ZDB71121