CAS 724711-21-1
:2-[2-(quinolin-3-yl)pyridin-4-yl]-1,5,6,7-tetrahydro-4H-pyrrolo[3,2-c]pyridin-4-one
Description:
The chemical substance known as 2-[2-(quinolin-3-yl)pyridin-4-yl]-1,5,6,7-tetrahydro-4H-pyrrolo[3,2-c]pyridin-4-one, with the CAS number 724711-21-1, is a complex organic compound characterized by its multi-cyclic structure, which includes both pyridine and quinoline moieties. This compound features a tetrahydropyrrolo structure, contributing to its potential biological activity. It is typically synthesized through multi-step organic reactions, which may involve the formation of various heterocycles. The presence of nitrogen atoms in its structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular conformation. Additionally, compounds of this nature may exhibit properties such as fluorescence or specific binding affinities, which can be explored in various applications, including drug discovery and development. Further studies would be necessary to fully elucidate its pharmacological profile and potential therapeutic uses.
Formula:C21H16N4O
InChI:InChI=1/C21H16N4O/c26-21-16-11-20(25-18(16)6-8-23-21)14-5-7-22-19(10-14)15-9-13-3-1-2-4-17(13)24-12-15/h1-5,7,9-12,25H,6,8H2,(H,23,26)
SMILES:c1ccc2c(c1)cc(cn2)c1cc(ccn1)c1cc2c(CCN=C2O)[nH]1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Ref: IN-DA01CBK3
1gTo inquire5mg135.00€10mg164.00€25mg260.00€50mg586.00€100mgTo inquire250mgTo inquire2-(2-(Quinolin-3-Yl)Pyridin-4-Yl)-6,7-Dihydro-1H-Pyrrolo[3,2-C]Pyridin-4(5H)-One
CAS:2-(2-(Quinolin-3-Yl)Pyridin-4-Yl)-6,7-Dihydro-1H-Pyrrolo[3,2-C]Pyridin-4(5H)-OnePurity:98%Molecular weight:340.38g/molMK2-IN-3
CAS:MK2-IN-3 is a potent MK-2 inhibitor, cell-permeable, for rheumatoid arthritis treatment.Formula:C21H16N4OPurity:99.01%Color and Shape:SolidMolecular weight:340.38Ref: TM-T9034
1mg34.00€5mg77.00€10mg111.00€25mg222.00€50mg350.00€100mg505.00€200mg690.00€1mL*10mM (DMSO)57.00€2-(2-(Quinolin-3-yl)pyridin-4-yl)-6,7-dihydro-1H-pyrrolo[3,2-c]pyridin-4(5H)-one
CAS:Purity:98+%Molecular weight:340.385986328125Ref: 10-F869389
1gTo inquire5mgTo inquire10mgTo inquire25mg227.00€50mg353.00€100mgTo inquire250mgTo inquireMk2 inhibitor III
CAS:MK2 Inhibitor III is a pharmacological agent, specifically a selective inhibitor, that intervenes in the MAPKAPK2 (MK2) signaling pathway. It is derived through chemical synthesis, designed to obstruct the activity of the mitogen-activated protein kinase-activated protein kinase 2 (MK2). This inhibition occurs through competitive binding at the ATP-binding site of MK2, effectively reducing the activity of this kinase involved in the stress response pathway.Formula:C21H16N4OPurity:Min. 95%Molecular weight:340.4 g/mol





