CymitQuimica logo

CAS 724742-88-5

:

2-(4-Bromophenyl)-6-(trifluoromethyl)imidazo[1,2-a]pyridine

Description:
2-(4-Bromophenyl)-6-(trifluoromethyl)imidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its imidazo[1,2-a]pyridine core, which features a bromophenyl substituent at the 2-position and a trifluoromethyl group at the 6-position. This compound exhibits notable biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the bromine atom and the trifluoromethyl group contributes to its lipophilicity and potential for interacting with biological targets. Additionally, the imidazo[1,2-a]pyridine structure is known for its ability to participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The compound's unique electronic properties, influenced by the electron-withdrawing trifluoromethyl group and the electron-donating bromophenyl group, can affect its reactivity and stability. Overall, this substance is a valuable compound in research, particularly in the fields of drug discovery and development.
Formula:C14H8BrF3N2
InChI:InChI=1S/C14H8BrF3N2/c15-11-4-1-9(2-5-11)12-8-20-7-10(14(16,17)18)3-6-13(20)19-12/h1-8H
InChI key:InChIKey=BOAZGHRSWMFFNM-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CN2C(=NC(=C2)C3=CC=C(Br)C=C3)C=C1
Synonyms:
  • 2-(4-Bromophenyl)-6-(trifluoromethyl)imidazo[1,2-a]pyridine
  • Imidazo[1,2-a]pyridine, 2-(4-bromophenyl)-6-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.