CAS 724749-10-4

5-[4-(dimethylamino)phenyl]-4-prop-2-en-1-yl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[4-(Dimethylamino)phenyl]-4-prop-2-en-1-yl-2,4-dihydro-3H-1,2,4-triazole-3-thione, with the CAS number 724749-10-4, is a chemical compound characterized by its complex structure, which includes a triazole ring and a dimethylamino group. This compound typically exhibits properties associated with thiones, such as potential reactivity in nucleophilic substitution reactions due to the presence of sulfur in the thione functional group. The dimethylamino moiety may enhance its solubility in organic solvents and influence its biological activity, making it of interest in medicinal chemistry. The presence of the prop-2-en-1-yl group suggests potential for further chemical modifications or polymerization reactions. Additionally, compounds of this nature may exhibit various biological activities, including antimicrobial or antifungal properties, although specific biological data would need to be referenced for detailed applications. Overall, this compound's unique structural features contribute to its potential utility in various chemical and pharmaceutical applications.

Formula: C₁₃H₁₆N₄S

InChI: InChI=1/C13H16N4S/c1-4-9-17-12(14-15-13(17)18)10-5-7-11(8-6-10)16(2)3/h4-8H,1,9H2,2-3H3,(H,15,18)

SMILES: C=CCn1c(c2ccc(cc2)N(C)C)nnc1S

4-allyl-5-[4-(dimethylamino)phenyl]-4H-1,2,4-triazole-3-thiol

CAS: 724749-10-4

Formula: C₁₃H₁₆N₄S

Purity: 95.0%

Molecular weight: 260.36

Ref: 10-F307746