CAS 724749-60-4

5-[1-(4-chloro-3-methylphenoxy)ethyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[1-(4-chloro-3-methylphenoxy)ethyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione, with the CAS number 724749-60-4, is a chemical compound characterized by its triazole core structure, which is a five-membered ring containing three nitrogen atoms. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential biological activity. The presence of a chloro-substituted aromatic ring enhances its lipophilicity, which may influence its interaction with biological targets. The ethyl and methyl groups attached to the triazole ring suggest that the compound may exhibit moderate to high molecular weight and specific steric properties. Such characteristics often play a crucial role in the compound's solubility, stability, and overall pharmacological profile. Compounds of this nature are often investigated for their potential applications in agriculture, particularly as fungicides or herbicides, due to their ability to interfere with biological processes in target organisms.

Formula: C₁₂H₁₄ClN₃OS

InChI: InChI=1/C12H14ClN3OS/c1-7-6-9(4-5-10(7)13)17-8(2)11-14-15-12(18)16(11)3/h4-6,8H,1-3H3,(H,15,18)

SMILES: Cc1cc(ccc1Cl)OC(C)c1nnc(n1C)S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 5-[1-(4-chloro-3-methylphenoxy)ethyl]-4-methyl-

5-[1-(4-chloro-3-methylphenoxy)ethyl]-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 724749-60-4

Formula: C₁₂H₁₄ClN₃OS

Purity: 95.0%

Molecular weight: 283.77

Ref: 10-F307822