CymitQuimica logo

CAS 724793-81-1

:

3-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-oxopropanoic acid

Description:
3-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-oxopropanoic acid, with the CAS number 724793-81-1, is a chemical compound characterized by its unique structure that includes an amino group, a carbonyl group, and a propanoic acid moiety. This compound features a dimethylethoxycarbonyl group, which contributes to its stability and solubility properties. It is typically a white to off-white solid and is soluble in polar solvents, making it useful in various chemical applications, including organic synthesis and pharmaceutical development. The presence of both an amino and a carboxylic acid functional group allows for potential reactivity in peptide synthesis and other coupling reactions. Additionally, the compound may exhibit specific biological activities, which can be explored in medicinal chemistry contexts. Its molecular structure and functional groups suggest that it may participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in different environments. Overall, this compound represents a versatile building block in organic chemistry.
Formula:C8H13NO5
InChI:InChI=1S/C8H13NO5/c1-8(2,3)14-7(13)9-4-5(10)6(11)12/h4H2,1-3H3,(H,9,13)(H,11,12)
InChI key:InChIKey=AJBNGTVCITWPPV-UHFFFAOYSA-N
SMILES:C(NCC(C(O)=O)=O)(OC(C)(C)C)=O
Synonyms:
  • 3-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-oxopropanoic acid
  • Propanoic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-2-oxo-
  • 3-((tert-Butoxycarbonyl)amino)-2-oxopropanoic acid
  • 3-[[(tert-Butoxy)carbonyl]amino]-2-oxopropanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.