CAS 7248-26-2

2-hydroxynaphthalene-1-carbohydrazide

Description:

2-Hydroxynaphthalene-1-carbohydrazide, with the CAS number 7248-26-2, is an organic compound characterized by its hydrazide functional group and a hydroxyl group attached to a naphthalene ring. This compound typically appears as a crystalline solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. It exhibits properties such as solubility in polar solvents, which can vary depending on the specific conditions and the presence of substituents. The presence of the hydroxyl group contributes to its reactivity, allowing it to participate in hydrogen bonding and other intermolecular interactions. Additionally, 2-hydroxynaphthalene-1-carbohydrazide may exhibit biological activity, making it of interest for research in medicinal chemistry. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its practical applications. Overall, this compound represents a versatile structure with potential utility in various chemical and biological contexts.

Formula: C₁₁H₁₀N₂O₂

InChI: InChI=1/C11H10N2O2/c12-13-11(15)10-8-4-2-1-3-7(8)5-6-9(10)14/h1-6,14H,12H2,(H,13,15)

SMILES: c1ccc2c(c1)ccc(c2C(=NN)O)O

Synonyms:

• 1-Naphthalenecarboxylic Acid, 2-Hydroxy-, Hydrazide