CAS 7248-88-6

ethyl 7-nitro-4-oxo-1,4-dihydroquinoline-3-carboxylate

Description:

Ethyl 7-nitro-4-oxo-1,4-dihydroquinoline-3-carboxylate, with the CAS number 7248-88-6, is a chemical compound that belongs to the class of quinoline derivatives. This substance typically exhibits a yellow crystalline appearance and is known for its potential biological activities, including antimicrobial and antitumor properties. The presence of the nitro group and the carboxylate moiety contributes to its reactivity and solubility characteristics. Ethyl 7-nitro-4-oxo-1,4-dihydroquinoline-3-carboxylate is often utilized in organic synthesis and medicinal chemistry as a building block for more complex molecules. Its structure allows for various chemical modifications, making it a versatile compound in research. Additionally, it may exhibit fluorescence, which can be advantageous in biological imaging applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.

Formula: C₁₂H₁₀N₂O₅

InChI: InChI=1/C12H10N2O5/c1-2-19-12(16)9-6-13-10-5-7(14(17)18)3-4-8(10)11(9)15/h3-6H,2H2,1H3,(H,13,15)

SMILES: CCOC(=O)c1c[nH]c2cc(ccc2c1=O)N(=O)=O

Ethyl 4-hydroxy-7-nitroquinoline-3-carboxylate

CAS: 7248-88-6

Ethyl 4-hydroxy-7-nitroquinoline-3-carboxylate

Purity: ≥95%

Molecular weight: 262.22g/mol

Ref: 54-OR183510

Ethyl 7-nitro-4-oxo-1,4-dihydroquinoline-3-carboxylate

CAS: 7248-88-6

Purity: 98%

Molecular weight: 262.2210083

Ref: 10-F775681