CAS 72482-64-5
:2,4-Difluorobenzoyl chloride
Description:
2,4-Difluorobenzoyl chloride is an aromatic compound characterized by the presence of both a benzoyl chloride functional group and two fluorine atoms positioned at the 2 and 4 positions of the benzene ring. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly due to the presence of the acyl chloride functional group, which can readily participate in nucleophilic acyl substitution reactions. The fluorine substituents enhance the electrophilicity of the carbonyl carbon, making it more susceptible to nucleophilic attack. Additionally, the presence of fluorine can influence the compound's physical properties, such as boiling point and solubility, often increasing its polarity compared to non-fluorinated analogs. 2,4-Difluorobenzoyl chloride is utilized in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals, owing to its ability to introduce the benzoyl and fluorine functionalities into target molecules. As with many acyl chlorides, it should be handled with care due to its corrosive nature and potential to release hydrochloric acid upon reaction with water or alcohols.
Formula:C7H3ClF2O
InChI:InChI=1S/C7H3ClF2O/c8-7(11)5-2-1-4(9)3-6(5)10/h1-3H
InChI key:InChIKey=JSWRVDNTKPAJLB-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1=C(F)C=C(F)C=C1
Synonyms:- 2,4-Difluorobenzoic acid chloride
- 2,4-Difluorobenzoyl chloride acid chloride
- Benzoyl chloride, 2,4-difluoro-
- Gvr Bf Df
- 2,4-Difluorobenzoyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,4-Difluorobenzoyl Chloride
CAS:Formula:C7H3ClF2OPurity:>98.0%(GC)(T)Color and Shape:White or Colorless to Light yellow powder to lump to clear liquidMolecular weight:176.552,4-Difluorobenzoyl chloride, 97%
CAS:<p>2,4-Difluorobenzoyl chloride is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU re</p>Formula:C7H3ClF2OPurity:97%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:176.552,4-DIFLUOROBENZOYL CHLORIDE
CAS:Formula:C7H3ClF2OPurity:98%Color and Shape:LiquidMolecular weight:176.54792,4-Difluorobenzoyl chloride
CAS:2,4-Difluorobenzoyl chlorideFormula:C7H3ClF2OPurity:97%Color and Shape: colourless liquidMolecular weight:176.55g/mol2,4-Difluorobenzoyl chloride
CAS:Formula:C7H3ClF2OPurity:98%Color and Shape:Liquid, ClearMolecular weight:176.55




