CAS 7249-16-3

3-[4-(acetyloxy)phenyl]propanoic acid

Description:

3-[4-(Acetyloxy)phenyl]propanoic acid, with the CAS number 7249-16-3, is an organic compound characterized by its structure, which includes a propanoic acid moiety attached to a phenyl group that is further substituted with an acetoxy group. This compound typically exhibits properties associated with both carboxylic acids and esters, such as the ability to form hydrogen bonds due to the presence of the carboxylic acid functional group. It is likely to be a white to off-white solid at room temperature and may be soluble in organic solvents while having limited solubility in water. The acetoxy group can influence its reactivity, making it a potential candidate for various chemical reactions, including esterification and acylation. Additionally, compounds of this nature may exhibit biological activity, which could be of interest in pharmaceutical applications. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₁₁H₁₂O₄

InChI: InChI=1/C11H12O4/c1-8(12)15-10-5-2-9(3-6-10)4-7-11(13)14/h2-3,5-6H,4,7H2,1H3,(H,13,14)

SMILES: CC(=O)Oc1ccc(cc1)CCC(=O)O

β-(4-ACETOXYPHENYL)PROPIONIC ACID

CAS: 7249-16-3

Formula: C₁₁H₁₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 208.2106

Ref: IN-DA0065SS

3-(4-Acetoxyphenyl)propanoic acid

CAS: 7249-16-3

3-(4-Acetoxyphenyl)propanoic acid

Purity: 95%

Molecular weight: 208.21g/mol

Ref: 54-OR1052665

β-(4-Acetoxyphenyl)propionic acid

CAS: 7249-16-3

Beta-Propionic acid is an organic compound that belongs to the group of monocarboxylic acids. The chemical name for beta-propionic acid is 2-oxopropanoic acid. Beta-Propionic acid has a molecular weight of 88.06 grams per mole and a melting point of -79 degrees Celsius. This product is soluble in water, ethanol, ether, and ethyl acetate. It also reacts with dilute alkalis to form salts such as sodium bicarbonate and potassium propionate. Beta-Propionic acid is used in the manufacturing of polyurethane plastics, as well as in the production of resins for paints and varnishes.

Formula: C₁₁H₁₂O₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 208.21 g/mol

Ref: 3D-FA70180

β-(4-Acetoxyphenyl)propionic acid

CAS: 7249-16-3

Formula: C₁₁H₁₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 208.213

Ref: 10-F210662