CymitQuimica logo

CAS 7249-82-3

:

N,N-diethyl-6-(piperidin-1-yl)hex-4-yn-1-amine

Description:
N,N-Diethyl-6-(piperidin-1-yl)hex-4-yn-1-amine, with the CAS number 7249-82-3, is a chemical compound characterized by its unique structure, which includes a hexynyl chain and a piperidine ring. This compound features two ethyl groups attached to the nitrogen atom, contributing to its amine classification. The presence of the alkyne functional group (hex-4-yn) indicates that it has a triple bond between carbon atoms, which can influence its reactivity and physical properties. Typically, compounds of this nature may exhibit moderate to high lipophilicity due to the presence of hydrophobic alkyl chains, which can affect their solubility in organic solvents. Additionally, the piperidine moiety may impart basicity and potential pharmacological activity, making it of interest in medicinal chemistry. The compound's structural complexity suggests potential applications in drug development or as a synthetic intermediate in organic synthesis. However, specific safety and handling information should be consulted from material safety data sheets (MSDS) or relevant literature before use.
Formula:C15H28N2
InChI:InChI=1/C15H28N2/c1-3-16(4-2)12-8-5-6-9-13-17-14-10-7-11-15-17/h3-5,7-8,10-15H2,1-2H3
SMILES:CCN(CC)CCCC#CCN1CCCCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.