CymitQuimica logo

CAS 725-04-2

:

N-(3-fluorobiphenyl-4-yl)acetamide

Description:
N-(3-fluorobiphenyl-4-yl)acetamide, with the CAS number 725-04-2, is an organic compound characterized by its amide functional group, which is derived from acetic acid and a substituted biphenyl moiety. This compound features a fluorine atom positioned on the biphenyl structure, specifically at the 3-position of one of the phenyl rings, which can influence its chemical reactivity and physical properties. The presence of the acetamide group contributes to its potential solubility in polar solvents and may affect its hydrogen bonding capabilities. Typically, compounds like this can exhibit interesting biological activities, making them of interest in pharmaceutical research. The molecular structure suggests that it may have moderate stability under standard conditions, but specific reactivity would depend on the surrounding environment and conditions. Additionally, the fluorine substitution can enhance lipophilicity and alter the electronic properties of the molecule, which may be relevant in various applications, including drug design and materials science.
Formula:C14H12FNO
InChI:InChI=1/C14H12FNO/c1-10(17)16-14-8-7-12(9-13(14)15)11-5-3-2-4-6-11/h2-9H,1H3,(H,16,17)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.