CAS 725-89-3
:3,5-Bis(trifluoromethyl)benzoic acid
Description:
3,5-Bis(trifluoromethyl)benzoic acid is an aromatic carboxylic acid characterized by the presence of two trifluoromethyl groups attached to the benzene ring at the 3 and 5 positions. This compound is notable for its strong electron-withdrawing trifluoromethyl groups, which significantly influence its chemical reactivity and physical properties. It typically appears as a white crystalline solid and is soluble in organic solvents, while exhibiting limited solubility in water due to its hydrophobic characteristics. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the trifluoromethyl groups enhance the compound's thermal stability and lipophilicity, making it useful in various applications, including pharmaceuticals and agrochemicals. Its unique structure and properties make it a subject of interest in materials science and organic synthesis. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C9H4F6O2
InChI:InChI=1S/C9H4F6O2/c10-8(11,12)5-1-4(7(16)17)2-6(3-5)9(13,14)15/h1-3H,(H,16,17)
InChI key:InChIKey=HVFQJWGYVXKLTE-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(C(F)(F)F)=CC(C(O)=O)=C1
Synonyms:- 2,6-Dibromo-4-(Trifluoromethyl)Aniline
- 3,5-Bis(Trifluoromethyl)Benzoate
- 3,5-Di(Trifluoromethyl)Benzoic Acid
- Benzoic acid, 3,5-bis(trifluoromethyl)-
- Mbt-Boa
- NSC 88282
- Rarechem Al Bo 0001
- Timtec-Bb Sbb000963
- 3,5-Bis(trifluoromethyl)benzoic acid
- 3,5-Bis-(Trifluoromethyl)-Benzoic Acid
- 3,5-Bis(trifluoromethyl)-benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3,5-Bis(trifluoromethyl)benzoic Acid
CAS:Formula:C9H4F6O2Purity:>98.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:258.123,5-Bis(trifluoromethyl)benzoic acid, 98%
CAS:In vitro metabolism studies on a series of 3,5-bis(trifluoromethyl)benzyl ethers have identified 3,5-bis(trifluoromethyl)benzoic acid as a significant metabolite possibly arising via oxidation of the benzylic position. The reactivity of the hydroxy- propyl units was demonstrated by the esterificatioFormula:C9H4F6O2Purity:98%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:258.123,5-Bis(trifluoromethyl)benzoic Acid
CAS:Formula:C9H4F6O2Purity:98%Color and Shape:SolidMolecular weight:258.11733,5-Bis(trifluoromethyl)benzoic acid
CAS:3,5-Bis(trifluoromethyl)benzoic acidFormula:C9H4F6O2Purity:97%Color and Shape: white crystalline solidMolecular weight:258.11727g/mol3,5-Bis(trifluoromethyl)benzoic acid
CAS:Formula:C9H4F6O2Purity:98%Color and Shape:Solid, Crystalline PowderMolecular weight:258.1193,5-Bis(trifluoromethyl)benzoic Acid
CAS:Controlled ProductFormula:C9H4F6O2Color and Shape:NeatMolecular weight:258.12






