CAS 725-92-8
:diethyl 4-oxo-4H-pyran-2,6-dicarboxylate
Description:
Diethyl 4-oxo-4H-pyran-2,6-dicarboxylate, with the CAS number 725-92-8, is an organic compound characterized by its pyran ring structure, which features two carboxylate groups and a ketone functionality. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity, particularly in organic synthesis, where it can participate in various chemical reactions such as esterification and cyclization. The presence of the diethyl ester groups enhances its solubility in organic solvents, making it useful in synthetic applications. Additionally, the compound may exhibit biological activity, which has drawn interest in medicinal chemistry. Its stability under standard conditions is generally good, but it should be handled with care due to potential reactivity with strong nucleophiles. Overall, diethyl 4-oxo-4H-pyran-2,6-dicarboxylate is a versatile compound with applications in both research and industrial chemistry.
Formula:C11H12O6
InChI:InChI=1/C11H12O6/c1-3-15-10(13)8-5-7(12)6-9(17-8)11(14)16-4-2/h5-6H,3-4H2,1-2H3
SMILES:CCOC(=O)c1cc(=O)cc(C(=O)OCC)o1
Synonyms:- 4H-Pyran-2,6-dicarboxylic acid, 4-oxo-, diethyl ester
- Diethyl 4-oxo-4H-pyran-2,6-dicarboxylate
- diethyl 4-oxopyran-2,6-dicarboxylate
- 4H-Pyran-2,6-dicarboxylic acid, 4-oxo-, 2,6-diethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
